C21H23FN4 — CID 70735350
3-[[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]methyl]-2-(4-fluorophenyl)imidazo[1,2-a]pyridine (PubChem CID 70735350) has the molecular formula C21H23FN4 and a molecular weight of 350.44 g/mol. Its IUPAC name is 3-[[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]methyl]-2-(4-fluorophenyl)imidazo[1,2-a]pyridine.
| Compound Name | 3-[[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]methyl]-2-(4-fluorophenyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 70735350 |
| Molecular Formula | C21H23FN4 |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 3-[[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]methyl]-2-(4-fluorophenyl)imidazo[1,2-a]pyridine |
| SMILES | CN1CC[C@H]2CN(Cc3c(-c4ccc(F)cc4)nc4ccccn34)C[C@H]21 |
| InChI | InChI=1S/C21H23FN4/c1-24-11-9-16-12-25(13-18(16)24)14-19-21(15-5-7-17(22)8-6-15)23-20-4-2-3-10-26(19)20/h2-8,10,16,18H,9,11-14H2,1H3/t16-,18+/m0/s1 |
| InChIKey | NRULYTSWPNKSKK-FUHWJXTLSA-N |
| XLogP | 3.28 |
| TPSA | 23.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |