C19H23N3O3 — CID 70735365
1-[4-[1-(cyclobutylmethyl)imidazol-2-yl]piperidin-1-yl]-2-(furan-2-yl)ethane-1,2-dione (PubChem CID 70735365) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-[4-[1-(cyclobutylmethyl)imidazol-2-yl]piperidin-1-yl]-2-(furan-2-yl)ethane-1,2-dione.
| Compound Name | 1-[4-[1-(cyclobutylmethyl)imidazol-2-yl]piperidin-1-yl]-2-(furan-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 70735365 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1-[4-[1-(cyclobutylmethyl)imidazol-2-yl]piperidin-1-yl]-2-(furan-2-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCC(c2nccn2CC2CCC2)CC1)c1ccco1 |
| InChI | InChI=1S/C19H23N3O3/c23-17(16-5-2-12-25-16)19(24)21-9-6-15(7-10-21)18-20-8-11-22(18)13-14-3-1-4-14/h2,5,8,11-12,14-15H,1,3-4,6-7,9-10,13H2 |
| InChIKey | ZITINVLKHGYRKU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|