C19H25N3O3 — CID 72884432
[4-[1-(cyclobutylmethyl)imidazol-2-yl]piperidin-1-yl]-(5-methoxyfuran-2-yl)methanone (PubChem CID 72884432) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is [4-[1-(cyclobutylmethyl)imidazol-2-yl]piperidin-1-yl]-(5-methoxyfuran-2-yl)methanone.
| Compound Name | [4-[1-(cyclobutylmethyl)imidazol-2-yl]piperidin-1-yl]-(5-methoxyfuran-2-yl)methanone |
|---|---|
| PubChem CID | 72884432 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | [4-[1-(cyclobutylmethyl)imidazol-2-yl]piperidin-1-yl]-(5-methoxyfuran-2-yl)methanone |
| SMILES | COc1ccc(C(=O)N2CCC(c3nccn3CC3CCC3)CC2)o1 |
| InChI | InChI=1S/C19H25N3O3/c1-24-17-6-5-16(25-17)19(23)21-10-7-15(8-11-21)18-20-9-12-22(18)13-14-3-2-4-14/h5-6,9,12,14-15H,2-4,7-8,10-11,13H2,1H3 |
| InChIKey | CVFKCIYYNNWDDA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 60.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |