C19H22N4O2S — CID 70736593
2-[[(3aS,6aS)-1-[(5-methylthiophen-2-yl)methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]methyl]-5-(furan-2-yl)-1,3,4-oxadiazole (PubChem CID 70736593) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is 2-[[(3aS,6aS)-1-[(5-methylthiophen-2-yl)methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]methyl]-5-(furan-2-yl)-1,3,4-oxadiazole.
| Compound Name | 2-[[(3aS,6aS)-1-[(5-methylthiophen-2-yl)methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]methyl]-5-(furan-2-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 70736593 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-[[(3aS,6aS)-1-[(5-methylthiophen-2-yl)methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]methyl]-5-(furan-2-yl)-1,3,4-oxadiazole |
| SMILES | Cc1ccc(CN2CC[C@H]3CN(Cc4nnc(-c5ccco5)o4)C[C@H]32)s1 |
| InChI | InChI=1S/C19H22N4O2S/c1-13-4-5-15(26-13)10-23-7-6-14-9-22(11-16(14)23)12-18-20-21-19(25-18)17-3-2-8-24-17/h2-5,8,14,16H,6-7,9-12H2,1H3/t14-,16+/m0/s1 |
| InChIKey | CEHSTCQQEXFBAS-GOEBONIOSA-N |
| XLogP | 3.41 |
| TPSA | 58.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |