C17H23N3O3 — CID 70737523
3-(hydroxymethyl)-1-[[1-(4-methoxyphenyl)imidazol-2-yl]methyl]piperidin-3-ol (PubChem CID 70737523) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 3-(hydroxymethyl)-1-[[1-(4-methoxyphenyl)imidazol-2-yl]methyl]piperidin-3-ol.
| Compound Name | 3-(hydroxymethyl)-1-[[1-(4-methoxyphenyl)imidazol-2-yl]methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 70737523 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 3-(hydroxymethyl)-1-[[1-(4-methoxyphenyl)imidazol-2-yl]methyl]piperidin-3-ol |
| SMILES | COc1ccc(-n2ccnc2CN2CCCC(O)(CO)C2)cc1 |
| InChI | InChI=1S/C17H23N3O3/c1-23-15-5-3-14(4-6-15)20-10-8-18-16(20)11-19-9-2-7-17(22,12-19)13-21/h3-6,8,10,21-22H,2,7,9,11-13H2,1H3 |
| InChIKey | KWWVSOCHKYRJFH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |