C20H30N2O2 — CID 70737550
2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1-[4-(piperidine-1-carbonyl)piperidin-1-yl]ethanone (PubChem CID 70737550) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1-[4-(piperidine-1-carbonyl)piperidin-1-yl]ethanone.
| Compound Name | 2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1-[4-(piperidine-1-carbonyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 70737550 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1-[4-(piperidine-1-carbonyl)piperidin-1-yl]ethanone |
| SMILES | O=C(C[C@@H]1C[C@@H]2C=C[C@H]1C2)N1CCC(C(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C20H30N2O2/c23-19(14-18-13-15-4-5-17(18)12-15)21-10-6-16(7-11-21)20(24)22-8-2-1-3-9-22/h4-5,15-18H,1-3,6-14H2/t15-,17+,18+/m1/s1 |
| InChIKey | BXZAXKIRUWQCMG-NJAFHUGGSA-N |
| XLogP | 2.84 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|