About 4-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-N-phenylpiperidine-1-carboxamide
4-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-N-phenylpiperidine-1-carboxamide (PubChem CID 70742226) has the molecular formula C21H31N3O3
and a molecular weight of 373.50 g/mol. Its IUPAC name is 4-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-N-phenylpiperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-N-phenylpiperidine-1-carboxamide |
| PubChem CID | 70742226 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 4-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-N-phenylpiperidine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1CCC(NC2CCOC3(CCOCC3)C2)CC1 |
| InChI | InChI=1S/C21H31N3O3/c25-20(23-17-4-2-1-3-5-17)24-11-6-18(7-12-24)22-19-8-13-27-21(16-19)9-14-26-15-10-21/h1-5,18-19,22H,6-16H2,(H,23,25) |
| InChIKey | RXRLCLXEWROMBW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-N-phenylpiperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-N-phenylpiperidine-1-carboxamide?
The IUPAC name of 4-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-N-phenylpiperidine-1-carboxamide (CID 70742226) is 4-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-N-phenylpiperidine-1-carboxamide.
What is the SMILES notation for 4-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-N-phenylpiperidine-1-carboxamide?
The canonical SMILES for 4-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-N-phenylpiperidine-1-carboxamide is O=C(Nc1ccccc1)N1CCC(NC2CCOC3(CCOCC3)C2)CC1.
What is the InChIKey of 4-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-N-phenylpiperidine-1-carboxamide?
The InChIKey is RXRLCLXEWROMBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31N3O3/c25-20(23-17-4-2-1-3-5-17)24-11-6-18(7-12-24)22-19-8-13-27-21(16-19)9-14-26-15-10-21/h1-5,18-19,22H,6-16H2,(H,23,25).
What are the key properties of 4-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-N-phenylpiperidine-1-carboxamide?
4-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-N-phenylpiperidine-1-carboxamide has a molecular weight of 373.50 g/mol, XLogP of 3.00, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-N-phenylpiperidine-1-carboxamide is sourced from PubChem (CID 70742226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).