C18H31N7O — CID 70742447
[3-(2-methylpiperidin-1-yl)azetidin-1-yl]-[1-(2-piperazin-1-ylethyl)triazol-4-yl]methanone (PubChem CID 70742447) has the molecular formula C18H31N7O and a molecular weight of 361.49 g/mol. Its IUPAC name is [3-(2-methylpiperidin-1-yl)azetidin-1-yl]-[1-(2-piperazin-1-ylethyl)triazol-4-yl]methanone.
| Compound Name | [3-(2-methylpiperidin-1-yl)azetidin-1-yl]-[1-(2-piperazin-1-ylethyl)triazol-4-yl]methanone |
|---|---|
| PubChem CID | 70742447 |
| Molecular Formula | C18H31N7O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | [3-(2-methylpiperidin-1-yl)azetidin-1-yl]-[1-(2-piperazin-1-ylethyl)triazol-4-yl]methanone |
| SMILES | CC1CCCCN1C1CN(C(=O)c2cn(CCN3CCNCC3)nn2)C1 |
| InChI | InChI=1S/C18H31N7O/c1-15-4-2-3-7-25(15)16-12-23(13-16)18(26)17-14-24(21-20-17)11-10-22-8-5-19-6-9-22/h14-16,19H,2-13H2,1H3 |
| InChIKey | QJGOVKYOPAMMQY-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |