C18H25N5O2 — CID 167907415
[(2S,6R)-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-[1-(2-morpholin-4-ylethyl)triazol-4-yl]methanone (PubChem CID 167907415) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is [(2S,6R)-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-[1-(2-morpholin-4-ylethyl)triazol-4-yl]methanone.
| Compound Name | [(2S,6R)-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-[1-(2-morpholin-4-ylethyl)triazol-4-yl]methanone |
|---|---|
| PubChem CID | 167907415 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | [(2S,6R)-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-[1-(2-morpholin-4-ylethyl)triazol-4-yl]methanone |
| SMILES | O=C(c1cn(CCN2CCOCC2)nn1)N1C[C@@H]2C3C=CC(C3)[C@@H]2C1 |
| InChI | InChI=1S/C18H25N5O2/c24-18(22-10-15-13-1-2-14(9-13)16(15)11-22)17-12-23(20-19-17)4-3-21-5-7-25-8-6-21/h1-2,12-16H,3-11H2/t13?,14?,15-,16+ |
| InChIKey | FJERMACOZWFTRJ-STONLHKKSA-N |
| XLogP | 0.50 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|