C16H19N5O3S — CID 70746938
N-[(5-methylsulfonyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-1,3-benzoxazol-2-amine (PubChem CID 70746938) has the molecular formula C16H19N5O3S and a molecular weight of 361.43 g/mol. Its IUPAC name is N-[(5-methylsulfonyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-1,3-benzoxazol-2-amine.
| Compound Name | N-[(5-methylsulfonyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 70746938 |
| Molecular Formula | C16H19N5O3S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-[(5-methylsulfonyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-1,3-benzoxazol-2-amine |
| SMILES | CS(=O)(=O)N1CCCn2nc(CNc3nc4ccccc4o3)cc2C1 |
| InChI | InChI=1S/C16H19N5O3S/c1-25(22,23)20-7-4-8-21-13(11-20)9-12(19-21)10-17-16-18-14-5-2-3-6-15(14)24-16/h2-3,5-6,9H,4,7-8,10-11H2,1H3,(H,17,18) |
| InChIKey | XDUDGWIIMJHWPQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |