C24H40O2 — CID 7074725
(2R,3S,5S,8R,9R,10S,13S,14R,17S)-2,10,13-trimethyl-17-propylspiro[2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,2'-oxirane]-17-ol (PubChem CID 7074725) has the molecular formula C24H40O2 and a molecular weight of 360.58 g/mol. Its IUPAC name is (2R,3S,5S,8R,9R,10S,13S,14R,17S)-2,10,13-trimethyl-17-propylspiro[2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,2'-oxirane]-17-ol.
| Compound Name | (2R,3S,5S,8R,9R,10S,13S,14R,17S)-2,10,13-trimethyl-17-propylspiro[2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,2'-oxirane]-17-ol |
|---|---|
| PubChem CID | 7074725 |
| Molecular Formula | C24H40O2 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | (2R,3S,5S,8R,9R,10S,13S,14R,17S)-2,10,13-trimethyl-17-propylspiro[2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,2'-oxirane]-17-ol |
| SMILES | CCC[C@]1(O)CC[C@@H]2[C@@H]3CC[C@H]4C[C@@]5(CO5)[C@H](C)C[C@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C24H40O2/c1-5-10-24(25)12-9-20-18-7-6-17-14-23(15-26-23)16(2)13-21(17,3)19(18)8-11-22(20,24)4/h16-20,25H,5-15H2,1-4H3/t16-,17+,18-,19-,20-,21+,22+,23-,24+/m1/s1 |
| InChIKey | DWXSJAAPPYYVFJ-PZTYKSJDSA-N |
| XLogP | 5.58 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|