C26H44O3 — CID 88606147
(1S,5S,8R,9S,10S,13S,14S,17S)-17-butyl-1,10,13-trimethylspiro[2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,3'-dioxolane]-17-ol (PubChem CID 88606147) has the molecular formula C26H44O3 and a molecular weight of 404.64 g/mol. Its IUPAC name is (1S,5S,8R,9S,10S,13S,14S,17S)-17-butyl-1,10,13-trimethylspiro[2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,3'-dioxolane]-17-ol.
| Compound Name | (1S,5S,8R,9S,10S,13S,14S,17S)-17-butyl-1,10,13-trimethylspiro[2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,3'-dioxolane]-17-ol |
|---|---|
| PubChem CID | 88606147 |
| Molecular Formula | C26H44O3 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | (1S,5S,8R,9S,10S,13S,14S,17S)-17-butyl-1,10,13-trimethylspiro[2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,3'-dioxolane]-17-ol |
| SMILES | CCCC[C@]1(O)CC[C@H]2[C@@H]3CC[C@H]4CC5(CCOO5)C[C@H](C)[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C26H44O3/c1-5-6-11-26(27)13-10-21-20-8-7-19-17-25(14-15-28-29-25)16-18(2)24(19,4)22(20)9-12-23(21,26)3/h18-22,27H,5-17H2,1-4H3/t18-,19-,20-,21-,22-,23-,24-,25?,26-/m0/s1 |
| InChIKey | QVXWMDYNDKYCLR-QIYRPRBWSA-N |
| XLogP | 6.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|