C26H40O4 — CID 70467189
(1'S,5'S,8'R,9'S,10'S,13'S,14'S,17'S)-17'-(4-hydroxybut-1-ynyl)-1',10',13'-trimethylspiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene]-17'-ol (PubChem CID 70467189) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is (1'S,5'S,8'R,9'S,10'S,13'S,14'S,17'S)-17'-(4-hydroxybut-1-ynyl)-1',10',13'-trimethylspiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene]-17'-ol.
| Compound Name | (1'S,5'S,8'R,9'S,10'S,13'S,14'S,17'S)-17'-(4-hydroxybut-1-ynyl)-1',10',13'-trimethylspiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene]-17'-ol |
|---|---|
| PubChem CID | 70467189 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | (1'S,5'S,8'R,9'S,10'S,13'S,14'S,17'S)-17'-(4-hydroxybut-1-ynyl)-1',10',13'-trimethylspiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene]-17'-ol |
| SMILES | C[C@H]1CC2(C[C@@H]3CC[C@@H]4[C@H](CC[C@@]5(C)[C@H]4CC[C@@]5(O)C#CCCO)[C@]31C)OCCO2 |
| InChI | InChI=1S/C26H40O4/c1-18-16-26(29-14-15-30-26)17-19-6-7-20-21-9-12-25(28,10-4-5-13-27)23(21,2)11-8-22(20)24(18,19)3/h18-22,27-28H,5-9,11-17H2,1-3H3/t18-,19-,20-,21-,22-,23-,24-,25-/m0/s1 |
| InChIKey | ZVHIEMQBOZYHRC-PRQSBNOCSA-N |
| XLogP | 4.14 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|