C23H29N3O2 — CID 70748407
4-(3-aminopropanoyl)-5-butyl-1-(3-phenylphenyl)piperazin-2-one (PubChem CID 70748407) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 4-(3-aminopropanoyl)-5-butyl-1-(3-phenylphenyl)piperazin-2-one.
| Compound Name | 4-(3-aminopropanoyl)-5-butyl-1-(3-phenylphenyl)piperazin-2-one |
|---|---|
| PubChem CID | 70748407 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 4-(3-aminopropanoyl)-5-butyl-1-(3-phenylphenyl)piperazin-2-one |
| SMILES | CCCCC1CN(c2cccc(-c3ccccc3)c2)C(=O)CN1C(=O)CCN |
| InChI | InChI=1S/C23H29N3O2/c1-2-3-11-21-16-25(23(28)17-26(21)22(27)13-14-24)20-12-7-10-19(15-20)18-8-5-4-6-9-18/h4-10,12,15,21H,2-3,11,13-14,16-17,24H2,1H3 |
| InChIKey | WBXCVNRPGREHOE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |