C22H28N4O2 — CID 70782872
5-butyl-4-(2-ethylpyrimidine-5-carbonyl)-1-(3-methylphenyl)piperazin-2-one (PubChem CID 70782872) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 5-butyl-4-(2-ethylpyrimidine-5-carbonyl)-1-(3-methylphenyl)piperazin-2-one.
| Compound Name | 5-butyl-4-(2-ethylpyrimidine-5-carbonyl)-1-(3-methylphenyl)piperazin-2-one |
|---|---|
| PubChem CID | 70782872 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 5-butyl-4-(2-ethylpyrimidine-5-carbonyl)-1-(3-methylphenyl)piperazin-2-one |
| SMILES | CCCCC1CN(c2cccc(C)c2)C(=O)CN1C(=O)c1cnc(CC)nc1 |
| InChI | InChI=1S/C22H28N4O2/c1-4-6-9-19-14-25(18-10-7-8-16(3)11-18)21(27)15-26(19)22(28)17-12-23-20(5-2)24-13-17/h7-8,10-13,19H,4-6,9,14-15H2,1-3H3 |
| InChIKey | PWSQIENNUUXFQL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |