C14H22N4S — CID 70748701
(3aS,6aS)-1-[(2-propylsulfanylpyrimidin-5-yl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole (PubChem CID 70748701) has the molecular formula C14H22N4S and a molecular weight of 278.42 g/mol. Its IUPAC name is (3aS,6aS)-1-[(2-propylsulfanylpyrimidin-5-yl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole.
| Compound Name | (3aS,6aS)-1-[(2-propylsulfanylpyrimidin-5-yl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 70748701 |
| Molecular Formula | C14H22N4S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | (3aS,6aS)-1-[(2-propylsulfanylpyrimidin-5-yl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
| SMILES | CCCSc1ncc(CN2CC[C@H]3CNC[C@H]32)cn1 |
| InChI | InChI=1S/C14H22N4S/c1-2-5-19-14-16-6-11(7-17-14)10-18-4-3-12-8-15-9-13(12)18/h6-7,12-13,15H,2-5,8-10H2,1H3/t12-,13+/m0/s1 |
| InChIKey | NRDNJKFYHWEPCO-QWHCGFSZSA-N |
| XLogP | 1.77 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |