C13H22N4S — CID 56711428
[1-[(2-propylsulfanylpyrimidin-5-yl)methyl]pyrrolidin-3-yl]methanamine (PubChem CID 56711428) has the molecular formula C13H22N4S and a molecular weight of 266.41 g/mol. Its IUPAC name is [1-[(2-propylsulfanylpyrimidin-5-yl)methyl]pyrrolidin-3-yl]methanamine.
| Compound Name | [1-[(2-propylsulfanylpyrimidin-5-yl)methyl]pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 56711428 |
| Molecular Formula | C13H22N4S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | [1-[(2-propylsulfanylpyrimidin-5-yl)methyl]pyrrolidin-3-yl]methanamine |
| SMILES | CCCSc1ncc(CN2CCC(CN)C2)cn1 |
| InChI | InChI=1S/C13H22N4S/c1-2-5-18-13-15-7-12(8-16-13)10-17-4-3-11(6-14)9-17/h7-8,11H,2-6,9-10,14H2,1H3 |
| InChIKey | PNDZGPNGLNJJSJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |