About 1-[(3S,4R)-3-(dimethylamino)-4-(4-methylphenyl)pyrrolidin-1-yl]-2-phenylsulfanylethanone
1-[(3S,4R)-3-(dimethylamino)-4-(4-methylphenyl)pyrrolidin-1-yl]-2-phenylsulfanylethanone (PubChem CID 70748789) has the molecular formula C21H26N2OS
and a molecular weight of 354.52 g/mol. Its IUPAC name is 1-[(3S,4R)-3-(dimethylamino)-4-(4-methylphenyl)pyrrolidin-1-yl]-2-phenylsulfanylethanone.
Molecular Properties
| Compound Name | 1-[(3S,4R)-3-(dimethylamino)-4-(4-methylphenyl)pyrrolidin-1-yl]-2-phenylsulfanylethanone |
| PubChem CID | 70748789 |
| Molecular Formula | C21H26N2OS |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1-[(3S,4R)-3-(dimethylamino)-4-(4-methylphenyl)pyrrolidin-1-yl]-2-phenylsulfanylethanone |
| SMILES | Cc1ccc([C@@H]2CN(C(=O)CSc3ccccc3)C[C@H]2N(C)C)cc1 |
| InChI | InChI=1S/C21H26N2OS/c1-16-9-11-17(12-10-16)19-13-23(14-20(19)22(2)3)21(24)15-25-18-7-5-4-6-8-18/h4-12,19-20H,13-15H2,1-3H3/t19-,20+/m0/s1 |
| InChIKey | HFYKIQNWIYKKKD-VQTJNVASSA-N |
| XLogP | 3.64 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3S,4R)-3-(dimethylamino)-4-(4-methylphenyl)pyrrolidin-1-yl]-2-phenylsulfanylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S,4R)-3-(dimethylamino)-4-(4-methylphenyl)pyrrolidin-1-yl]-2-phenylsulfanylethanone?
The IUPAC name of 1-[(3S,4R)-3-(dimethylamino)-4-(4-methylphenyl)pyrrolidin-1-yl]-2-phenylsulfanylethanone (CID 70748789) is 1-[(3S,4R)-3-(dimethylamino)-4-(4-methylphenyl)pyrrolidin-1-yl]-2-phenylsulfanylethanone.
What is the SMILES notation for 1-[(3S,4R)-3-(dimethylamino)-4-(4-methylphenyl)pyrrolidin-1-yl]-2-phenylsulfanylethanone?
The canonical SMILES for 1-[(3S,4R)-3-(dimethylamino)-4-(4-methylphenyl)pyrrolidin-1-yl]-2-phenylsulfanylethanone is Cc1ccc([C@@H]2CN(C(=O)CSc3ccccc3)C[C@H]2N(C)C)cc1.
What is the InChIKey of 1-[(3S,4R)-3-(dimethylamino)-4-(4-methylphenyl)pyrrolidin-1-yl]-2-phenylsulfanylethanone?
The InChIKey is HFYKIQNWIYKKKD-VQTJNVASSA-N. The full InChI is InChI=1S/C21H26N2OS/c1-16-9-11-17(12-10-16)19-13-23(14-20(19)22(2)3)21(24)15-25-18-7-5-4-6-8-18/h4-12,19-20H,13-15H2,1-3H3/t19-,20+/m0/s1.
What are the key properties of 1-[(3S,4R)-3-(dimethylamino)-4-(4-methylphenyl)pyrrolidin-1-yl]-2-phenylsulfanylethanone?
1-[(3S,4R)-3-(dimethylamino)-4-(4-methylphenyl)pyrrolidin-1-yl]-2-phenylsulfanylethanone has a molecular weight of 354.52 g/mol, XLogP of 3.64, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S,4R)-3-(dimethylamino)-4-(4-methylphenyl)pyrrolidin-1-yl]-2-phenylsulfanylethanone is sourced from PubChem (CID 70748789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).