C18H26N2O — CID 91940500
1-[(3S,4R)-3-(dimethylamino)-4-(4-methylphenyl)pyrrolidin-1-yl]pent-3-en-1-one (PubChem CID 91940500) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 1-[(3S,4R)-3-(dimethylamino)-4-(4-methylphenyl)pyrrolidin-1-yl]pent-3-en-1-one.
| Compound Name | 1-[(3S,4R)-3-(dimethylamino)-4-(4-methylphenyl)pyrrolidin-1-yl]pent-3-en-1-one |
|---|---|
| PubChem CID | 91940500 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 1-[(3S,4R)-3-(dimethylamino)-4-(4-methylphenyl)pyrrolidin-1-yl]pent-3-en-1-one |
| SMILES | CC=CCC(=O)N1C[C@@H](N(C)C)[C@H](c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C18H26N2O/c1-5-6-7-18(21)20-12-16(17(13-20)19(3)4)15-10-8-14(2)9-11-15/h5-6,8-11,16-17H,7,12-13H2,1-4H3/t16-,17+/m0/s1 |
| InChIKey | SNPWIHDBLBEYLU-DLBZAZTESA-N |
| XLogP | 2.82 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|