C21H26N4O2 — CID 70753002
5-cyclohexyl-N-[(2S)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-1H-pyrazole-4-carboxamide (PubChem CID 70753002) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 5-cyclohexyl-N-[(2S)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-cyclohexyl-N-[(2S)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 70753002 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 5-cyclohexyl-N-[(2S)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-1H-pyrazole-4-carboxamide |
| SMILES | O=C(N[C@H](CO)Cc1c[nH]c2ccccc12)c1cn[nH]c1C1CCCCC1 |
| InChI | InChI=1S/C21H26N4O2/c26-13-16(10-15-11-22-19-9-5-4-8-17(15)19)24-21(27)18-12-23-25-20(18)14-6-2-1-3-7-14/h4-5,8-9,11-12,14,16,22,26H,1-3,6-7,10,13H2,(H,23,25)(H,24,27)/t16-/m0/s1 |
| InChIKey | NZKWTTFRPNKFOL-INIZCTEOSA-N |
| XLogP | 3.27 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |