C17H17FN4O4 — CID 70753750
2-[(4-fluorophenoxy)methyl]-6-oxo-N-(2-oxopiperidin-3-yl)-1H-pyrimidine-5-carboxamide (PubChem CID 70753750) has the molecular formula C17H17FN4O4 and a molecular weight of 360.35 g/mol. Its IUPAC name is 2-[(4-fluorophenoxy)methyl]-6-oxo-N-(2-oxopiperidin-3-yl)-1H-pyrimidine-5-carboxamide.
| Compound Name | 2-[(4-fluorophenoxy)methyl]-6-oxo-N-(2-oxopiperidin-3-yl)-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 70753750 |
| Molecular Formula | C17H17FN4O4 |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 2-[(4-fluorophenoxy)methyl]-6-oxo-N-(2-oxopiperidin-3-yl)-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(NC1CCCNC1=O)c1cnc(COc2ccc(F)cc2)[nH]c1=O |
| InChI | InChI=1S/C17H17FN4O4/c18-10-3-5-11(6-4-10)26-9-14-20-8-12(16(24)22-14)15(23)21-13-2-1-7-19-17(13)25/h3-6,8,13H,1-2,7,9H2,(H,19,25)(H,21,23)(H,20,22,24) |
| InChIKey | WJQLPALBQRXHCU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |