C18H24N4O2S — CID 70756520
(4aR,7aS)-1-methyl-4-[[1-(3-methylphenyl)pyrazol-4-yl]methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 70756520) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is (4aR,7aS)-1-methyl-4-[[1-(3-methylphenyl)pyrazol-4-yl]methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-1-methyl-4-[[1-(3-methylphenyl)pyrazol-4-yl]methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 70756520 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (4aR,7aS)-1-methyl-4-[[1-(3-methylphenyl)pyrazol-4-yl]methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | Cc1cccc(-n2cc(CN3CCN(C)[C@@H]4CS(=O)(=O)C[C@@H]43)cn2)c1 |
| InChI | InChI=1S/C18H24N4O2S/c1-14-4-3-5-16(8-14)22-11-15(9-19-22)10-21-7-6-20(2)17-12-25(23,24)13-18(17)21/h3-5,8-9,11,17-18H,6-7,10,12-13H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | LCPOKOSOFVTQBY-MSOLQXFVSA-N |
| XLogP | 1.09 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |