C21H21N5O — CID 70758350
(2-amino-4-phenylpyrimidin-5-yl)-(4-pyridin-4-ylpiperidin-1-yl)methanone (PubChem CID 70758350) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is (2-amino-4-phenylpyrimidin-5-yl)-(4-pyridin-4-ylpiperidin-1-yl)methanone.
| Compound Name | (2-amino-4-phenylpyrimidin-5-yl)-(4-pyridin-4-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 70758350 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (2-amino-4-phenylpyrimidin-5-yl)-(4-pyridin-4-ylpiperidin-1-yl)methanone |
| SMILES | Nc1ncc(C(=O)N2CCC(c3ccncc3)CC2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H21N5O/c22-21-24-14-18(19(25-21)17-4-2-1-3-5-17)20(27)26-12-8-16(9-13-26)15-6-10-23-11-7-15/h1-7,10-11,14,16H,8-9,12-13H2,(H2,22,24,25) |
| InChIKey | ZEUGZRKDLCVYEH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |