C19H18F2N2O2 — CID 70759120
4-(3,5-difluorobenzoyl)-5-methyl-1-(2-methylphenyl)piperazin-2-one (PubChem CID 70759120) has the molecular formula C19H18F2N2O2 and a molecular weight of 344.36 g/mol. Its IUPAC name is 4-(3,5-difluorobenzoyl)-5-methyl-1-(2-methylphenyl)piperazin-2-one.
| Compound Name | 4-(3,5-difluorobenzoyl)-5-methyl-1-(2-methylphenyl)piperazin-2-one |
|---|---|
| PubChem CID | 70759120 |
| Molecular Formula | C19H18F2N2O2 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 4-(3,5-difluorobenzoyl)-5-methyl-1-(2-methylphenyl)piperazin-2-one |
| SMILES | Cc1ccccc1N1CC(C)N(C(=O)c2cc(F)cc(F)c2)CC1=O |
| InChI | InChI=1S/C19H18F2N2O2/c1-12-5-3-4-6-17(12)23-10-13(2)22(11-18(23)24)19(25)14-7-15(20)9-16(21)8-14/h3-9,13H,10-11H2,1-2H3 |
| InChIKey | BMKOXMBYROEIHN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |