C21H31N3O2 — CID 70759934
N-[[4-(dimethylamino)oxan-4-yl]methyl]-2-(2,5,7-trimethyl-1H-indol-3-yl)acetamide (PubChem CID 70759934) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is N-[[4-(dimethylamino)oxan-4-yl]methyl]-2-(2,5,7-trimethyl-1H-indol-3-yl)acetamide.
| Compound Name | N-[[4-(dimethylamino)oxan-4-yl]methyl]-2-(2,5,7-trimethyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 70759934 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | N-[[4-(dimethylamino)oxan-4-yl]methyl]-2-(2,5,7-trimethyl-1H-indol-3-yl)acetamide |
| SMILES | Cc1cc(C)c2[nH]c(C)c(CC(=O)NCC3(N(C)C)CCOCC3)c2c1 |
| InChI | InChI=1S/C21H31N3O2/c1-14-10-15(2)20-18(11-14)17(16(3)23-20)12-19(25)22-13-21(24(4)5)6-8-26-9-7-21/h10-11,23H,6-9,12-13H2,1-5H3,(H,22,25) |
| InChIKey | DNNHBHBMZXHWSY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|