C16H20N2O3 — CID 97119156
1-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]-2-(2,5,7-trimethyl-1H-indol-3-yl)ethanone (PubChem CID 97119156) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]-2-(2,5,7-trimethyl-1H-indol-3-yl)ethanone.
| Compound Name | 1-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]-2-(2,5,7-trimethyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 97119156 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 1-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]-2-(2,5,7-trimethyl-1H-indol-3-yl)ethanone |
| SMILES | Cc1cc(C)c2[nH]c(C)c(CC(=O)N3C[C@@H](O)CO3)c2c1 |
| InChI | InChI=1S/C16H20N2O3/c1-9-4-10(2)16-14(5-9)13(11(3)17-16)6-15(20)18-7-12(19)8-21-18/h4-5,12,17,19H,6-8H2,1-3H3/t12-/m1/s1 |
| InChIKey | DEGTXAHHJKFTOX-GFCCVEGCSA-N |
| XLogP | 1.77 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|