C17H25N3OS — CID 70764539
1-[[1-[5-(methylsulfanylmethyl)-2-pyridinyl]piperidin-4-yl]methyl]pyrrolidin-2-one (PubChem CID 70764539) has the molecular formula C17H25N3OS and a molecular weight of 319.47 g/mol. Its IUPAC name is 1-[[1-[5-(methylsulfanylmethyl)-2-pyridinyl]piperidin-4-yl]methyl]pyrrolidin-2-one.
| Compound Name | 1-[[1-[5-(methylsulfanylmethyl)-2-pyridinyl]piperidin-4-yl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 70764539 |
| Molecular Formula | C17H25N3OS |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 1-[[1-[5-(methylsulfanylmethyl)-2-pyridinyl]piperidin-4-yl]methyl]pyrrolidin-2-one |
| SMILES | CSCc1ccc(N2CCC(CN3CCCC3=O)CC2)nc1 |
| InChI | InChI=1S/C17H25N3OS/c1-22-13-15-4-5-16(18-11-15)19-9-6-14(7-10-19)12-20-8-2-3-17(20)21/h4-5,11,14H,2-3,6-10,12-13H2,1H3 |
| InChIKey | MEDIEBVDCZNGNI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |