C18H29N3S — CID 96582044
5-(methylsulfanylmethyl)-2-[(3R)-3-(piperidin-1-ylmethyl)piperidin-1-yl]pyridine (PubChem CID 96582044) has the molecular formula C18H29N3S and a molecular weight of 319.52 g/mol. Its IUPAC name is 5-(methylsulfanylmethyl)-2-[(3R)-3-(piperidin-1-ylmethyl)piperidin-1-yl]pyridine.
| Compound Name | 5-(methylsulfanylmethyl)-2-[(3R)-3-(piperidin-1-ylmethyl)piperidin-1-yl]pyridine |
|---|---|
| PubChem CID | 96582044 |
| Molecular Formula | C18H29N3S |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 5-(methylsulfanylmethyl)-2-[(3R)-3-(piperidin-1-ylmethyl)piperidin-1-yl]pyridine |
| SMILES | CSCc1ccc(N2CCC[C@H](CN3CCCCC3)C2)nc1 |
| InChI | InChI=1S/C18H29N3S/c1-22-15-16-7-8-18(19-12-16)21-11-5-6-17(14-21)13-20-9-3-2-4-10-20/h7-8,12,17H,2-6,9-11,13-15H2,1H3/t17-/m1/s1 |
| InChIKey | YETLXLRZUZVWEV-QGZVFWFLSA-N |
| XLogP | 3.65 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |