About 2-[4-[3-(3,5-dimethylpyrazol-1-yl)azetidine-1-carbonyl]piperidin-1-yl]acetamide
2-[4-[3-(3,5-dimethylpyrazol-1-yl)azetidine-1-carbonyl]piperidin-1-yl]acetamide (PubChem CID 70765400) has the molecular formula C16H25N5O2
and a molecular weight of 319.41 g/mol. Its IUPAC name is 2-[4-[3-(3,5-dimethylpyrazol-1-yl)azetidine-1-carbonyl]piperidin-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-[4-[3-(3,5-dimethylpyrazol-1-yl)azetidine-1-carbonyl]piperidin-1-yl]acetamide |
| PubChem CID | 70765400 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 2-[4-[3-(3,5-dimethylpyrazol-1-yl)azetidine-1-carbonyl]piperidin-1-yl]acetamide |
| SMILES | Cc1cc(C)n(C2CN(C(=O)C3CCN(CC(N)=O)CC3)C2)n1 |
| InChI | InChI=1S/C16H25N5O2/c1-11-7-12(2)21(18-11)14-8-20(9-14)16(23)13-3-5-19(6-4-13)10-15(17)22/h7,13-14H,3-6,8-10H2,1-2H3,(H2,17,22) |
| InChIKey | NTPKIYWKIIGKDO-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[3-(3,5-dimethylpyrazol-1-yl)azetidine-1-carbonyl]piperidin-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[3-(3,5-dimethylpyrazol-1-yl)azetidine-1-carbonyl]piperidin-1-yl]acetamide?
The IUPAC name of 2-[4-[3-(3,5-dimethylpyrazol-1-yl)azetidine-1-carbonyl]piperidin-1-yl]acetamide (CID 70765400) is 2-[4-[3-(3,5-dimethylpyrazol-1-yl)azetidine-1-carbonyl]piperidin-1-yl]acetamide.
What is the SMILES notation for 2-[4-[3-(3,5-dimethylpyrazol-1-yl)azetidine-1-carbonyl]piperidin-1-yl]acetamide?
The canonical SMILES for 2-[4-[3-(3,5-dimethylpyrazol-1-yl)azetidine-1-carbonyl]piperidin-1-yl]acetamide is Cc1cc(C)n(C2CN(C(=O)C3CCN(CC(N)=O)CC3)C2)n1.
What is the InChIKey of 2-[4-[3-(3,5-dimethylpyrazol-1-yl)azetidine-1-carbonyl]piperidin-1-yl]acetamide?
The InChIKey is NTPKIYWKIIGKDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N5O2/c1-11-7-12(2)21(18-11)14-8-20(9-14)16(23)13-3-5-19(6-4-13)10-15(17)22/h7,13-14H,3-6,8-10H2,1-2H3,(H2,17,22).
What are the key properties of 2-[4-[3-(3,5-dimethylpyrazol-1-yl)azetidine-1-carbonyl]piperidin-1-yl]acetamide?
2-[4-[3-(3,5-dimethylpyrazol-1-yl)azetidine-1-carbonyl]piperidin-1-yl]acetamide has a molecular weight of 319.41 g/mol, XLogP of 0.08, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3-(3,5-dimethylpyrazol-1-yl)azetidine-1-carbonyl]piperidin-1-yl]acetamide is sourced from PubChem (CID 70765400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).