C17H26N4O — CID 95141116
2-[(3S)-3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]-N,N-bis(prop-2-enyl)acetamide (PubChem CID 95141116) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-[(3S)-3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-[(3S)-3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 95141116 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 2-[(3S)-3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)CN1CC[C@H](n2nc(C)cc2C)C1 |
| InChI | InChI=1S/C17H26N4O/c1-5-8-20(9-6-2)17(22)13-19-10-7-16(12-19)21-15(4)11-14(3)18-21/h5-6,11,16H,1-2,7-10,12-13H2,3-4H3/t16-/m0/s1 |
| InChIKey | NLFIUVRFHWHWBP-INIZCTEOSA-N |
| XLogP | 1.95 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|