C18H22N6O3 — CID 70766784
1-ethyl-8-[3-(1-methylpyrrol-2-yl)-1H-pyrazole-5-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 70766784) has the molecular formula C18H22N6O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 1-ethyl-8-[3-(1-methylpyrrol-2-yl)-1H-pyrazole-5-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-ethyl-8-[3-(1-methylpyrrol-2-yl)-1H-pyrazole-5-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 70766784 |
| Molecular Formula | C18H22N6O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-ethyl-8-[3-(1-methylpyrrol-2-yl)-1H-pyrazole-5-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCN1C(=O)NC(=O)C12CCN(C(=O)c1cc(-c3cccn3C)n[nH]1)CC2 |
| InChI | InChI=1S/C18H22N6O3/c1-3-24-17(27)19-16(26)18(24)6-9-23(10-7-18)15(25)13-11-12(20-21-13)14-5-4-8-22(14)2/h4-5,8,11H,3,6-7,9-10H2,1-2H3,(H,20,21)(H,19,26,27) |
| InChIKey | QTAYDZNELFXXHL-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|