C11H15N7OS — CID 70769656
N-[2-(2H-triazol-4-ylsulfanyl)ethyl]-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-4-carboxamide (PubChem CID 70769656) has the molecular formula C11H15N7OS and a molecular weight of 293.36 g/mol. Its IUPAC name is N-[2-(2H-triazol-4-ylsulfanyl)ethyl]-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-4-carboxamide.
| Compound Name | N-[2-(2H-triazol-4-ylsulfanyl)ethyl]-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 70769656 |
| Molecular Formula | C11H15N7OS |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | N-[2-(2H-triazol-4-ylsulfanyl)ethyl]-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-4-carboxamide |
| SMILES | O=C(NCCSc1cn[nH]n1)C1NCCc2[nH]cnc21 |
| InChI | InChI=1S/C11H15N7OS/c19-11(13-3-4-20-8-5-16-18-17-8)10-9-7(1-2-12-10)14-6-15-9/h5-6,10,12H,1-4H2,(H,13,19)(H,14,15)(H,16,17,18) |
| InChIKey | RJTOYRFKMZRTCW-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|