C12H16N6OS2 — CID 95872075
(4S)-N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-4-carboxamide (PubChem CID 95872075) has the molecular formula C12H16N6OS2 and a molecular weight of 324.44 g/mol. Its IUPAC name is (4S)-N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-4-carboxamide.
| Compound Name | (4S)-N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 95872075 |
| Molecular Formula | C12H16N6OS2 |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | (4S)-N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-4-carboxamide |
| SMILES | Cc1nnc(SCCNC(=O)[C@H]2NCCc3[nH]cnc32)s1 |
| InChI | InChI=1S/C12H16N6OS2/c1-7-17-18-12(21-7)20-5-4-14-11(19)10-9-8(2-3-13-10)15-6-16-9/h6,10,13H,2-5H2,1H3,(H,14,19)(H,15,16)/t10-/m0/s1 |
| InChIKey | VNLYRUSVBOPQNK-JTQLQIEISA-N |
| XLogP | 0.66 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|