C9H10N6O2 — CID 70769894
[3-(6-methylpyridazin-3-yl)-1,2,4-oxadiazol-5-yl]methylurea (PubChem CID 70769894) has the molecular formula C9H10N6O2 and a molecular weight of 234.22 g/mol. Its IUPAC name is [3-(6-methylpyridazin-3-yl)-1,2,4-oxadiazol-5-yl]methylurea.
| Compound Name | [3-(6-methylpyridazin-3-yl)-1,2,4-oxadiazol-5-yl]methylurea |
|---|---|
| PubChem CID | 70769894 |
| Molecular Formula | C9H10N6O2 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | [3-(6-methylpyridazin-3-yl)-1,2,4-oxadiazol-5-yl]methylurea |
| SMILES | Cc1ccc(-c2noc(CNC(N)=O)n2)nn1 |
| InChI | InChI=1S/C9H10N6O2/c1-5-2-3-6(14-13-5)8-12-7(17-15-8)4-11-9(10)16/h2-3H,4H2,1H3,(H3,10,11,16) |
| InChIKey | FDUXCOCWNAWZAH-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |