C22H34N2O3 — CID 70770536
[3-(3-hydroxy-3-methylbutyl)phenyl]-[4-(3-hydroxypiperidin-1-yl)piperidin-1-yl]methanone (PubChem CID 70770536) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is [3-(3-hydroxy-3-methylbutyl)phenyl]-[4-(3-hydroxypiperidin-1-yl)piperidin-1-yl]methanone.
| Compound Name | [3-(3-hydroxy-3-methylbutyl)phenyl]-[4-(3-hydroxypiperidin-1-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 70770536 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | [3-(3-hydroxy-3-methylbutyl)phenyl]-[4-(3-hydroxypiperidin-1-yl)piperidin-1-yl]methanone |
| SMILES | CC(C)(O)CCc1cccc(C(=O)N2CCC(N3CCCC(O)C3)CC2)c1 |
| InChI | InChI=1S/C22H34N2O3/c1-22(2,27)11-8-17-5-3-6-18(15-17)21(26)23-13-9-19(10-14-23)24-12-4-7-20(25)16-24/h3,5-6,15,19-20,25,27H,4,7-14,16H2,1-2H3 |
| InChIKey | GDCHQAPMSQCUNI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |