C21H33NO3 — CID 95867172
[3-(3-hydroxy-3-methylbutyl)phenyl]-[4-[(2R)-1-methoxypropan-2-yl]piperidin-1-yl]methanone (PubChem CID 95867172) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is [3-(3-hydroxy-3-methylbutyl)phenyl]-[4-[(2R)-1-methoxypropan-2-yl]piperidin-1-yl]methanone.
| Compound Name | [3-(3-hydroxy-3-methylbutyl)phenyl]-[4-[(2R)-1-methoxypropan-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95867172 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | [3-(3-hydroxy-3-methylbutyl)phenyl]-[4-[(2R)-1-methoxypropan-2-yl]piperidin-1-yl]methanone |
| SMILES | COC[C@H](C)C1CCN(C(=O)c2cccc(CCC(C)(C)O)c2)CC1 |
| InChI | InChI=1S/C21H33NO3/c1-16(15-25-4)18-9-12-22(13-10-18)20(23)19-7-5-6-17(14-19)8-11-21(2,3)24/h5-7,14,16,18,24H,8-13,15H2,1-4H3/t16-/m0/s1 |
| InChIKey | FJLAZVJDGHMEND-INIZCTEOSA-N |
| XLogP | 3.52 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |