C19H23FN4OS — CID 70771223
[5-(3-fluorophenyl)-1H-pyrazol-4-yl]-[4-(thian-4-yl)piperazin-1-yl]methanone (PubChem CID 70771223) has the molecular formula C19H23FN4OS and a molecular weight of 374.49 g/mol. Its IUPAC name is [5-(3-fluorophenyl)-1H-pyrazol-4-yl]-[4-(thian-4-yl)piperazin-1-yl]methanone.
| Compound Name | [5-(3-fluorophenyl)-1H-pyrazol-4-yl]-[4-(thian-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 70771223 |
| Molecular Formula | C19H23FN4OS |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [5-(3-fluorophenyl)-1H-pyrazol-4-yl]-[4-(thian-4-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cn[nH]c1-c1cccc(F)c1)N1CCN(C2CCSCC2)CC1 |
| InChI | InChI=1S/C19H23FN4OS/c20-15-3-1-2-14(12-15)18-17(13-21-22-18)19(25)24-8-6-23(7-9-24)16-4-10-26-11-5-16/h1-3,12-13,16H,4-11H2,(H,21,22) |
| InChIKey | NMFQQEBUBMFRQP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |