C16H18FN3O4 — CID 70771545
5-[3-[3-[(2-fluorophenyl)methoxy]azetidin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione (PubChem CID 70771545) has the molecular formula C16H18FN3O4 and a molecular weight of 335.34 g/mol. Its IUPAC name is 5-[3-[3-[(2-fluorophenyl)methoxy]azetidin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione.
| Compound Name | 5-[3-[3-[(2-fluorophenyl)methoxy]azetidin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70771545 |
| Molecular Formula | C16H18FN3O4 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 5-[3-[3-[(2-fluorophenyl)methoxy]azetidin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CCC(=O)N2CC(OCc3ccccc3F)C2)N1 |
| InChI | InChI=1S/C16H18FN3O4/c17-12-4-2-1-3-10(12)9-24-11-7-20(8-11)14(21)6-5-13-15(22)19-16(23)18-13/h1-4,11,13H,5-9H2,(H2,18,19,22,23) |
| InChIKey | KCKUCUYJNVIRPC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|