C14H14N6O3S — CID 70772607
3-(2,5-dioxoimidazolidin-4-yl)-N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]propanamide (PubChem CID 70772607) has the molecular formula C14H14N6O3S and a molecular weight of 346.37 g/mol. Its IUPAC name is 3-(2,5-dioxoimidazolidin-4-yl)-N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]propanamide.
| Compound Name | 3-(2,5-dioxoimidazolidin-4-yl)-N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 70772607 |
| Molecular Formula | C14H14N6O3S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 3-(2,5-dioxoimidazolidin-4-yl)-N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]propanamide |
| SMILES | O=C(CCC1NC(=O)NC1=O)NCc1csc(-c2cnccn2)n1 |
| InChI | InChI=1S/C14H14N6O3S/c21-11(2-1-9-12(22)20-14(23)19-9)17-5-8-7-24-13(18-8)10-6-15-3-4-16-10/h3-4,6-7,9H,1-2,5H2,(H,17,21)(H2,19,20,22,23) |
| InChIKey | YOYDMPGUPBKPMD-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 125.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|