C12H16N4O3S — CID 97130974
3-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[(4-ethyl-1,3-thiazol-2-yl)methyl]propanamide (PubChem CID 97130974) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is 3-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[(4-ethyl-1,3-thiazol-2-yl)methyl]propanamide.
| Compound Name | 3-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[(4-ethyl-1,3-thiazol-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 97130974 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 3-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[(4-ethyl-1,3-thiazol-2-yl)methyl]propanamide |
| SMILES | CCc1csc(CNC(=O)CC[C@H]2NC(=O)NC2=O)n1 |
| InChI | InChI=1S/C12H16N4O3S/c1-2-7-6-20-10(14-7)5-13-9(17)4-3-8-11(18)16-12(19)15-8/h6,8H,2-5H2,1H3,(H,13,17)(H2,15,16,18,19)/t8-/m1/s1 |
| InChIKey | LTJKELAIRZESFC-MRVPVSSYSA-N |
| XLogP | 0.31 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|