C20H27N3O3 — CID 70773055
1-cyclohexyl-3-(cyclopropylmethyl)-N-(2-hydroxyethyl)-2-oxobenzimidazole-5-carboxamide (PubChem CID 70773055) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 1-cyclohexyl-3-(cyclopropylmethyl)-N-(2-hydroxyethyl)-2-oxobenzimidazole-5-carboxamide.
| Compound Name | 1-cyclohexyl-3-(cyclopropylmethyl)-N-(2-hydroxyethyl)-2-oxobenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 70773055 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-cyclohexyl-3-(cyclopropylmethyl)-N-(2-hydroxyethyl)-2-oxobenzimidazole-5-carboxamide |
| SMILES | O=C(NCCO)c1ccc2c(c1)n(CC1CC1)c(=O)n2C1CCCCC1 |
| InChI | InChI=1S/C20H27N3O3/c24-11-10-21-19(25)15-8-9-17-18(12-15)22(13-14-6-7-14)20(26)23(17)16-4-2-1-3-5-16/h8-9,12,14,16,24H,1-7,10-11,13H2,(H,21,25) |
| InChIKey | NJSONGZMEJDFGY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |