C20H23N3O3 — CID 70773066
6-methoxy-2-oxo-N-(4-pyridin-2-ylbutyl)-3,4-dihydro-1H-quinoline-4-carboxamide (PubChem CID 70773066) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 6-methoxy-2-oxo-N-(4-pyridin-2-ylbutyl)-3,4-dihydro-1H-quinoline-4-carboxamide.
| Compound Name | 6-methoxy-2-oxo-N-(4-pyridin-2-ylbutyl)-3,4-dihydro-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 70773066 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 6-methoxy-2-oxo-N-(4-pyridin-2-ylbutyl)-3,4-dihydro-1H-quinoline-4-carboxamide |
| SMILES | COc1ccc2c(c1)C(C(=O)NCCCCc1ccccn1)CC(=O)N2 |
| InChI | InChI=1S/C20H23N3O3/c1-26-15-8-9-18-16(12-15)17(13-19(24)23-18)20(25)22-11-5-3-7-14-6-2-4-10-21-14/h2,4,6,8-10,12,17H,3,5,7,11,13H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | VJJWNMQKEFZBKK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|