C13H17NO5 — CID 70773826
2-[(3S)-3-ethylmorpholine-4-carbonyl]-5-methoxypyran-4-one (PubChem CID 70773826) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-[(3S)-3-ethylmorpholine-4-carbonyl]-5-methoxypyran-4-one.
| Compound Name | 2-[(3S)-3-ethylmorpholine-4-carbonyl]-5-methoxypyran-4-one |
|---|---|
| PubChem CID | 70773826 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-[(3S)-3-ethylmorpholine-4-carbonyl]-5-methoxypyran-4-one |
| SMILES | CC[C@H]1COCCN1C(=O)c1cc(=O)c(OC)co1 |
| InChI | InChI=1S/C13H17NO5/c1-3-9-7-18-5-4-14(9)13(16)11-6-10(15)12(17-2)8-19-11/h6,8-9H,3-5,7H2,1-2H3/t9-/m0/s1 |
| InChIKey | UZEZOFHIJOLINY-VIFPVBQESA-N |
| XLogP | 0.90 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |