C17H20ClN5 — CID 70774818
4-chloro-1-methyl-3-[1-(1-methylpiperidin-3-yl)imidazol-2-yl]indazole (PubChem CID 70774818) has the molecular formula C17H20ClN5 and a molecular weight of 329.84 g/mol. Its IUPAC name is 4-chloro-1-methyl-3-[1-(1-methylpiperidin-3-yl)imidazol-2-yl]indazole.
| Compound Name | 4-chloro-1-methyl-3-[1-(1-methylpiperidin-3-yl)imidazol-2-yl]indazole |
|---|---|
| PubChem CID | 70774818 |
| Molecular Formula | C17H20ClN5 |
| Molecular Weight | 329.84 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 4-chloro-1-methyl-3-[1-(1-methylpiperidin-3-yl)imidazol-2-yl]indazole |
| SMILES | CN1CCCC(n2ccnc2-c2nn(C)c3cccc(Cl)c23)C1 |
| InChI | InChI=1S/C17H20ClN5/c1-21-9-4-5-12(11-21)23-10-8-19-17(23)16-15-13(18)6-3-7-14(15)22(2)20-16/h3,6-8,10,12H,4-5,9,11H2,1-2H3 |
| InChIKey | FJYOYRQONAHLGU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.84 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |