C22H24N4O — CID 70775196
(4-phenyl-1,4-diazepan-1-yl)-[3-(pyrazol-1-ylmethyl)phenyl]methanone (PubChem CID 70775196) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is (4-phenyl-1,4-diazepan-1-yl)-[3-(pyrazol-1-ylmethyl)phenyl]methanone.
| Compound Name | (4-phenyl-1,4-diazepan-1-yl)-[3-(pyrazol-1-ylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 70775196 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (4-phenyl-1,4-diazepan-1-yl)-[3-(pyrazol-1-ylmethyl)phenyl]methanone |
| SMILES | O=C(c1cccc(Cn2cccn2)c1)N1CCCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H24N4O/c27-22(20-8-4-7-19(17-20)18-26-14-5-11-23-26)25-13-6-12-24(15-16-25)21-9-2-1-3-10-21/h1-5,7-11,14,17H,6,12-13,15-16,18H2 |
| InChIKey | LHQQVDNUDSMEME-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |