C21H21N3O2 — CID 95147815
[(3S)-3-hydroxy-3-phenylpyrrolidin-1-yl]-[3-(pyrazol-1-ylmethyl)phenyl]methanone (PubChem CID 95147815) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is [(3S)-3-hydroxy-3-phenylpyrrolidin-1-yl]-[3-(pyrazol-1-ylmethyl)phenyl]methanone.
| Compound Name | [(3S)-3-hydroxy-3-phenylpyrrolidin-1-yl]-[3-(pyrazol-1-ylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 95147815 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | [(3S)-3-hydroxy-3-phenylpyrrolidin-1-yl]-[3-(pyrazol-1-ylmethyl)phenyl]methanone |
| SMILES | O=C(c1cccc(Cn2cccn2)c1)N1CC[C@](O)(c2ccccc2)C1 |
| InChI | InChI=1S/C21H21N3O2/c25-20(18-7-4-6-17(14-18)15-24-12-5-11-22-24)23-13-10-21(26,16-23)19-8-2-1-3-9-19/h1-9,11-12,14,26H,10,13,15-16H2/t21-/m1/s1 |
| InChIKey | FUGZLBUYDZVLEV-OAQYLSRUSA-N |
| XLogP | 2.67 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |