C22H23ClN2O3 — CID 70778486
(3R)-1-[[2-(3-chlorophenyl)-5,8-dimethoxyquinolin-3-yl]methyl]pyrrolidin-3-ol (PubChem CID 70778486) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is (3R)-1-[[2-(3-chlorophenyl)-5,8-dimethoxyquinolin-3-yl]methyl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[[2-(3-chlorophenyl)-5,8-dimethoxyquinolin-3-yl]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 70778486 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (3R)-1-[[2-(3-chlorophenyl)-5,8-dimethoxyquinolin-3-yl]methyl]pyrrolidin-3-ol |
| SMILES | COc1ccc(OC)c2nc(-c3cccc(Cl)c3)c(CN3CC[C@@H](O)C3)cc12 |
| InChI | InChI=1S/C22H23ClN2O3/c1-27-19-6-7-20(28-2)22-18(19)11-15(12-25-9-8-17(26)13-25)21(24-22)14-4-3-5-16(23)10-14/h3-7,10-11,17,26H,8-9,12-13H2,1-2H3/t17-/m1/s1 |
| InChIKey | NWJHTOXQNZGGQR-QGZVFWFLSA-N |
| XLogP | 4.14 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |