C20H16O3 — CID 707839
2,3,4-trimethyl-9-phenylfuro[2,3-f]chromen-7-one (PubChem CID 707839) has the molecular formula C20H16O3 and a molecular weight of 304.34 g/mol. Its IUPAC name is 2,3,4-trimethyl-9-phenylfuro[2,3-f]chromen-7-one.
| Compound Name | 2,3,4-trimethyl-9-phenylfuro[2,3-f]chromen-7-one |
|---|---|
| PubChem CID | 707839 |
| Molecular Formula | C20H16O3 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2,3,4-trimethyl-9-phenylfuro[2,3-f]chromen-7-one |
| SMILES | Cc1oc2c(c(C)cc3oc(=O)cc(-c4ccccc4)c32)c1C |
| InChI | InChI=1S/C20H16O3/c1-11-9-16-19(20-18(11)12(2)13(3)22-20)15(10-17(21)23-16)14-7-5-4-6-8-14/h4-10H,1-3H3 |
| InChIKey | MBDBUSOFVNUVKA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|