C31H35NO2 — CID 71548783
6-[4-[ethyl(hexyl)amino]phenyl]-5,7-dimethyl-4-phenylchromen-2-one (PubChem CID 71548783) has the molecular formula C31H35NO2 and a molecular weight of 453.63 g/mol. Its IUPAC name is 6-[4-[ethyl(hexyl)amino]phenyl]-5,7-dimethyl-4-phenylchromen-2-one.
| Compound Name | 6-[4-[ethyl(hexyl)amino]phenyl]-5,7-dimethyl-4-phenylchromen-2-one |
|---|---|
| PubChem CID | 71548783 |
| Molecular Formula | C31H35NO2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | 6-[4-[ethyl(hexyl)amino]phenyl]-5,7-dimethyl-4-phenylchromen-2-one |
| SMILES | CCCCCCN(CC)c1ccc(-c2c(C)cc3oc(=O)cc(-c4ccccc4)c3c2C)cc1 |
| InChI | InChI=1S/C31H35NO2/c1-5-7-8-12-19-32(6-2)26-17-15-25(16-18-26)30-22(3)20-28-31(23(30)4)27(21-29(33)34-28)24-13-10-9-11-14-24/h9-11,13-18,20-21H,5-8,12,19H2,1-4H3 |
| InChIKey | IVMUGVGVIQLXST-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|