C21H22O4 — CID 134912197
7-hexyl-5,6-dihydroxy-4-phenylchromen-2-one (PubChem CID 134912197) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is 7-hexyl-5,6-dihydroxy-4-phenylchromen-2-one.
| Compound Name | 7-hexyl-5,6-dihydroxy-4-phenylchromen-2-one |
|---|---|
| PubChem CID | 134912197 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 7-hexyl-5,6-dihydroxy-4-phenylchromen-2-one |
| SMILES | CCCCCCc1cc2oc(=O)cc(-c3ccccc3)c2c(O)c1O |
| InChI | InChI=1S/C21H22O4/c1-2-3-4-6-11-15-12-17-19(21(24)20(15)23)16(13-18(22)25-17)14-9-7-5-8-10-14/h5,7-10,12-13,23-24H,2-4,6,11H2,1H3 |
| InChIKey | DGTOZDCOPKTURO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|